C28H34ClNO3Si — CID 71546916
(6R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-7a-[(2S)-pyrrolidin-2-yl]-6,7-dihydro-1-benzofuran-2-one;hydrochloride (PubChem CID 71546916) has the molecular formula C28H34ClNO3Si and a molecular weight of 496.12 g/mol. Its IUPAC name is (6R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-7a-[(2S)-pyrrolidin-2-yl]-6,7-dihydro-1-benzofuran-2-one;hydrochloride.
| Compound Name | (6R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-7a-[(2S)-pyrrolidin-2-yl]-6,7-dihydro-1-benzofuran-2-one;hydrochloride |
|---|---|
| PubChem CID | 71546916 |
| Molecular Formula | C28H34ClNO3Si |
| Molecular Weight | 496.12 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (6R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-7a-[(2S)-pyrrolidin-2-yl]-6,7-dihydro-1-benzofuran-2-one;hydrochloride |
| SMILES | CC(C)(C)[Si](O[C@H]1C=CC2=CC(=O)O[C@@]2([C@@H]2CCCN2)C1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C28H33NO3Si.ClH/c1-27(2,3)33(23-11-6-4-7-12-23,24-13-8-5-9-14-24)32-22-17-16-21-19-26(30)31-28(21,20-22)25-15-10-18-29-25;/h4-9,11-14,16-17,19,22,25,29H,10,15,18,20H2,1-3H3;1H/t22-,25-,28-;/m0./s1 |
| InChIKey | YOVOFPZTGUTQBL-JEIRORPYSA-N |
| XLogP | 4.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.12 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|