C28H33NO4Si — CID 71547059
(6R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-7a-[(2S)-1-hydroxypyrrolidin-2-yl]-6,7-dihydro-1-benzofuran-2-one (PubChem CID 71547059) has the molecular formula C28H33NO4Si and a molecular weight of 475.66 g/mol. Its IUPAC name is (6R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-7a-[(2S)-1-hydroxypyrrolidin-2-yl]-6,7-dihydro-1-benzofuran-2-one.
| Compound Name | (6R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-7a-[(2S)-1-hydroxypyrrolidin-2-yl]-6,7-dihydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 71547059 |
| Molecular Formula | C28H33NO4Si |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | (6R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-7a-[(2S)-1-hydroxypyrrolidin-2-yl]-6,7-dihydro-1-benzofuran-2-one |
| SMILES | CC(C)(C)[Si](O[C@H]1C=CC2=CC(=O)O[C@@]2([C@@H]2CCCN2O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO4Si/c1-27(2,3)34(23-11-6-4-7-12-23,24-13-8-5-9-14-24)33-22-17-16-21-19-26(30)32-28(21,20-22)25-15-10-18-29(25)31/h4-9,11-14,16-17,19,22,25,31H,10,15,18,20H2,1-3H3/t22-,25-,28-/m0/s1 |
| InChIKey | PFLZGIZCABZFCQ-ULNCZQIZSA-N |
| XLogP | 3.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|