C20H26N2O6 — CID 71548106
(1S,5S,12R,13S,18S,21R)-12,13,18,21-tetrahydroxy-15,15-dimethyl-20-oxa-7,9-diazahexacyclo[10.6.2.15,11.01,14.02,11.06,10]henicosa-6,9-dien-8-one (PubChem CID 71548106) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is (1S,5S,12R,13S,18S,21R)-12,13,18,21-tetrahydroxy-15,15-dimethyl-20-oxa-7,9-diazahexacyclo[10.6.2.15,11.01,14.02,11.06,10]henicosa-6,9-dien-8-one.
| Compound Name | (1S,5S,12R,13S,18S,21R)-12,13,18,21-tetrahydroxy-15,15-dimethyl-20-oxa-7,9-diazahexacyclo[10.6.2.15,11.01,14.02,11.06,10]henicosa-6,9-dien-8-one |
|---|---|
| PubChem CID | 71548106 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (1S,5S,12R,13S,18S,21R)-12,13,18,21-tetrahydroxy-15,15-dimethyl-20-oxa-7,9-diazahexacyclo[10.6.2.15,11.01,14.02,11.06,10]henicosa-6,9-dien-8-one |
| SMILES | CC1(C)CC[C@H](O)[C@]23CO[C@@](O)([C@@H](O)C12)C12C4=NC(=O)N=C4[C@H](CCC13)[C@H]2O |
| InChI | InChI=1S/C20H26N2O6/c1-17(2)6-5-10(23)18-7-28-20(27,15(25)12(17)18)19-9(18)4-3-8(14(19)24)11-13(19)22-16(26)21-11/h8-10,12,14-15,23-25,27H,3-7H2,1-2H3/t8-,9?,10-,12?,14+,15-,18+,19?,20-/m0/s1 |
| InChIKey | OCCSCTFIEFOLRN-FKRYVWQFSA-N |
| XLogP | 0.27 |
| TPSA | 131.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |