C16H14N5O5P — CID 71548554
[3-[[(6-oxo-2-pyridazin-3-yl-1H-pyrimidine-5-carbonyl)amino]methyl]phenyl]phosphonic acid (PubChem CID 71548554) has the molecular formula C16H14N5O5P and a molecular weight of 387.29 g/mol. Its IUPAC name is [3-[[(6-oxo-2-pyridazin-3-yl-1H-pyrimidine-5-carbonyl)amino]methyl]phenyl]phosphonic acid.
| Compound Name | [3-[[(6-oxo-2-pyridazin-3-yl-1H-pyrimidine-5-carbonyl)amino]methyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 71548554 |
| Molecular Formula | C16H14N5O5P |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [3-[[(6-oxo-2-pyridazin-3-yl-1H-pyrimidine-5-carbonyl)amino]methyl]phenyl]phosphonic acid |
| SMILES | O=C(NCc1cccc(P(=O)(O)O)c1)c1cnc(-c2cccnn2)[nH]c1=O |
| InChI | InChI=1S/C16H14N5O5P/c22-15(18-8-10-3-1-4-11(7-10)27(24,25)26)12-9-17-14(20-16(12)23)13-5-2-6-19-21-13/h1-7,9H,8H2,(H,18,22)(H,17,20,23)(H2,24,25,26) |
| InChIKey | ONKNKWXOGWDTQI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|