C16H13N5O4S — CID 53494713
N-(4-methylphenyl)sulfonyl-6-oxo-2-pyridazin-3-yl-1H-pyrimidine-5-carboxamide (PubChem CID 53494713) has the molecular formula C16H13N5O4S and a molecular weight of 371.38 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-6-oxo-2-pyridazin-3-yl-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(4-methylphenyl)sulfonyl-6-oxo-2-pyridazin-3-yl-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 53494713 |
| Molecular Formula | C16H13N5O4S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-6-oxo-2-pyridazin-3-yl-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)c2cnc(-c3cccnn3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C16H13N5O4S/c1-10-4-6-11(7-5-10)26(24,25)21-16(23)12-9-17-14(19-15(12)22)13-3-2-8-18-20-13/h2-9H,1H3,(H,21,23)(H,17,19,22) |
| InChIKey | CKXPUPPPDXLMRE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |