C18H18N5O5P — CID 71547334
ethoxy-[(R)-[(6-oxo-2-pyridazin-3-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phosphinic acid (PubChem CID 71547334) has the molecular formula C18H18N5O5P and a molecular weight of 415.35 g/mol. Its IUPAC name is ethoxy-[(R)-[(6-oxo-2-pyridazin-3-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phosphinic acid.
| Compound Name | ethoxy-[(R)-[(6-oxo-2-pyridazin-3-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phosphinic acid |
|---|---|
| PubChem CID | 71547334 |
| Molecular Formula | C18H18N5O5P |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | ethoxy-[(R)-[(6-oxo-2-pyridazin-3-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phosphinic acid |
| SMILES | CCOP(=O)(O)[C@@H](NC(=O)c1cnc(-c2cccnn2)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C18H18N5O5P/c1-2-28-29(26,27)18(12-7-4-3-5-8-12)22-17(25)13-11-19-15(21-16(13)24)14-9-6-10-20-23-14/h3-11,18H,2H2,1H3,(H,22,25)(H,26,27)(H,19,21,24)/t18-/m1/s1 |
| InChIKey | JHRXHMRNHBCYLP-GOSISDBHSA-N |
| XLogP | 1.88 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|