C24H20N4O4P+ — CID 89462761
hydroxy-oxo-[[4-[[(6-oxo-2-pyridin-2-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phenyl]methyl]phosphanium (PubChem CID 89462761) has the molecular formula C24H20N4O4P+ and a molecular weight of 459.42 g/mol. Its IUPAC name is hydroxy-oxo-[[4-[[(6-oxo-2-pyridin-2-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phenyl]methyl]phosphanium.
| Compound Name | hydroxy-oxo-[[4-[[(6-oxo-2-pyridin-2-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phenyl]methyl]phosphanium |
|---|---|
| PubChem CID | 89462761 |
| Molecular Formula | C24H20N4O4P+ |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | hydroxy-oxo-[[4-[[(6-oxo-2-pyridin-2-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phenyl]methyl]phosphanium |
| SMILES | O=C(NC(c1ccccc1)c1ccc(C[P+](=O)O)cc1)c1cnc(-c2ccccn2)[nH]c1=O |
| InChI | InChI=1S/C24H19N4O4P/c29-23(19-14-26-22(28-24(19)30)20-8-4-5-13-25-20)27-21(17-6-2-1-3-7-17)18-11-9-16(10-12-18)15-33(31)32/h1-14,21H,15H2,(H2-,26,27,28,29,30,31,32)/p+1 |
| InChIKey | DMBZNAVQUUYKRU-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|