C17H14N4O5P+ — CID 118218438
hydroxy-oxo-[[(6-oxo-2-pyridin-2-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethoxy]phosphanium (PubChem CID 118218438) has the molecular formula C17H14N4O5P+ and a molecular weight of 385.30 g/mol. Its IUPAC name is hydroxy-oxo-[[(6-oxo-2-pyridin-2-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethoxy]phosphanium.
| Compound Name | hydroxy-oxo-[[(6-oxo-2-pyridin-2-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethoxy]phosphanium |
|---|---|
| PubChem CID | 118218438 |
| Molecular Formula | C17H14N4O5P+ |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | hydroxy-oxo-[[(6-oxo-2-pyridin-2-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethoxy]phosphanium |
| SMILES | O=C(NC(O[P+](=O)O)c1ccccc1)c1cnc(-c2ccccn2)[nH]c1=O |
| InChI | InChI=1S/C17H13N4O5P/c22-15-12(10-19-14(20-15)13-8-4-5-9-18-13)16(23)21-17(26-27(24)25)11-6-2-1-3-7-11/h1-10,17H,(H2-,19,20,21,22,23,24,25)/p+1 |
| InChIKey | UTAFXDMAZMLLKY-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|