C27H28N4O5P+ — CID 89462711
butane;hydroxy-oxo-[4-[[(6-oxo-2-pyridin-2-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phenoxy]phosphanium (PubChem CID 89462711) has the molecular formula C27H28N4O5P+ and a molecular weight of 519.52 g/mol. Its IUPAC name is butane;hydroxy-oxo-[4-[[(6-oxo-2-pyridin-2-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phenoxy]phosphanium.
| Compound Name | butane;hydroxy-oxo-[4-[[(6-oxo-2-pyridin-2-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phenoxy]phosphanium |
|---|---|
| PubChem CID | 89462711 |
| Molecular Formula | C27H28N4O5P+ |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | butane;hydroxy-oxo-[4-[[(6-oxo-2-pyridin-2-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phenoxy]phosphanium |
| SMILES | CCCC.O=C(NC(c1ccccc1)c1ccc(O[P+](=O)O)cc1)c1cnc(-c2ccccn2)[nH]c1=O |
| InChI | InChI=1S/C23H17N4O5P.C4H10/c28-22(18-14-25-21(27-23(18)29)19-8-4-5-13-24-19)26-20(15-6-2-1-3-7-15)16-9-11-17(12-10-16)32-33(30)31;1-3-4-2/h1-14,20H,(H2-,25,26,27,28,29,30,31);3-4H2,1-2H3/p+1 |
| InChIKey | FETNDQCCSXAUKM-UHFFFAOYSA-O |
| XLogP | 5.19 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|