C18H21N3OS — CID 71551097
N-(2-butyl-[1,3]thiazolo[4,5-c]quinolin-4-yl)butanamide (PubChem CID 71551097) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is N-(2-butyl-[1,3]thiazolo[4,5-c]quinolin-4-yl)butanamide.
| Compound Name | N-(2-butyl-[1,3]thiazolo[4,5-c]quinolin-4-yl)butanamide |
|---|---|
| PubChem CID | 71551097 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-(2-butyl-[1,3]thiazolo[4,5-c]quinolin-4-yl)butanamide |
| SMILES | CCCCc1nc2c(NC(=O)CCC)nc3ccccc3c2s1 |
| InChI | InChI=1S/C18H21N3OS/c1-3-5-11-15-21-16-17(23-15)12-9-6-7-10-13(12)19-18(16)20-14(22)8-4-2/h6-7,9-10H,3-5,8,11H2,1-2H3,(H,19,20,22) |
| InChIKey | BCOHTAAOUORPQF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |