C17H20N3O2S2+ — CID 7155231
13-(morpholin-4-ium-4-ylmethyl)-8,12-dithia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one (PubChem CID 7155231) has the molecular formula C17H20N3O2S2+ and a molecular weight of 362.50 g/mol. Its IUPAC name is 13-(morpholin-4-ium-4-ylmethyl)-8,12-dithia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one.
| Compound Name | 13-(morpholin-4-ium-4-ylmethyl)-8,12-dithia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one |
|---|---|
| PubChem CID | 7155231 |
| Molecular Formula | C17H20N3O2S2+ |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 13-(morpholin-4-ium-4-ylmethyl)-8,12-dithia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one |
| SMILES | O=c1c2c3c(sc2nc2sc(C[NH+]4CCOCC4)cn12)CCCC3 |
| InChI | InChI=1S/C17H19N3O2S2/c21-16-14-12-3-1-2-4-13(12)24-15(14)18-17-20(16)10-11(23-17)9-19-5-7-22-8-6-19/h10H,1-9H2/p+1 |
| InChIKey | CVEXCQRTGUXYCE-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |