C33H24N6O2 — CID 71552641
9-acetyl-2,4-diamino-7-(4-methylphenyl)-8-oxo-5,10-diphenylpyrido[2,3-h][1,6]naphthyridine-3-carbonitrile (PubChem CID 71552641) has the molecular formula C33H24N6O2 and a molecular weight of 536.60 g/mol. Its IUPAC name is 9-acetyl-2,4-diamino-7-(4-methylphenyl)-8-oxo-5,10-diphenylpyrido[2,3-h][1,6]naphthyridine-3-carbonitrile.
| Compound Name | 9-acetyl-2,4-diamino-7-(4-methylphenyl)-8-oxo-5,10-diphenylpyrido[2,3-h][1,6]naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 71552641 |
| Molecular Formula | C33H24N6O2 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 9-acetyl-2,4-diamino-7-(4-methylphenyl)-8-oxo-5,10-diphenylpyrido[2,3-h][1,6]naphthyridine-3-carbonitrile |
| SMILES | CC(=O)c1c(-c2ccccc2)c2c3nc(N)c(C#N)c(N)c3c(-c3ccccc3)nc2n(-c2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C33H24N6O2/c1-18-13-15-22(16-14-18)39-32-26(25(20-9-5-3-6-10-20)24(19(2)40)33(39)41)30-27(28(35)23(17-34)31(36)37-30)29(38-32)21-11-7-4-8-12-21/h3-16H,1-2H3,(H4,35,36,37) |
| InChIKey | JUZMIWHOGXHNQV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|