C40H41BrN6 — CID 71552799
2-[3-[[4-[[(6-bromonaphthalen-2-yl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenyl]methyl-(naphthalen-1-ylmethyl)amino]propyl]guanidine (PubChem CID 71552799) has the molecular formula C40H41BrN6 and a molecular weight of 685.71 g/mol. Its IUPAC name is 2-[3-[[4-[[(6-bromonaphthalen-2-yl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenyl]methyl-(naphthalen-1-ylmethyl)amino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[[(6-bromonaphthalen-2-yl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenyl]methyl-(naphthalen-1-ylmethyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 71552799 |
| Molecular Formula | C40H41BrN6 |
| Molecular Weight | 685.71 g/mol |
| Exact Mass | 684.26 |
| IUPAC Name | 2-[3-[[4-[[(6-bromonaphthalen-2-yl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenyl]methyl-(naphthalen-1-ylmethyl)amino]propyl]guanidine |
| SMILES | NC(N)=NCCCN(Cc1ccc(CN(Cc2ccc3cc(Br)ccc3c2)Cc2ccccn2)cc1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C40H41BrN6/c41-37-19-18-34-23-32(16-17-35(34)24-37)27-47(29-38-10-3-4-20-44-38)26-31-14-12-30(13-15-31)25-46(22-6-21-45-40(42)43)28-36-9-5-8-33-7-1-2-11-39(33)36/h1-5,7-20,23-24H,6,21-22,25-29H2,(H4,42,43,45) |
| InChIKey | WZSMOSYNBBASHU-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.71 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|