C22H30N6O3 — CID 71553008
N-(2-acetamidoethyl)-4-(cyclopentylamino)-2-[(2-methoxyphenyl)methylamino]pyrimidine-5-carboxamide (PubChem CID 71553008) has the molecular formula C22H30N6O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4-(cyclopentylamino)-2-[(2-methoxyphenyl)methylamino]pyrimidine-5-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-4-(cyclopentylamino)-2-[(2-methoxyphenyl)methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 71553008 |
| Molecular Formula | C22H30N6O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-(2-acetamidoethyl)-4-(cyclopentylamino)-2-[(2-methoxyphenyl)methylamino]pyrimidine-5-carboxamide |
| SMILES | COc1ccccc1CNc1ncc(C(=O)NCCNC(C)=O)c(NC2CCCC2)n1 |
| InChI | InChI=1S/C22H30N6O3/c1-15(29)23-11-12-24-21(30)18-14-26-22(28-20(18)27-17-8-4-5-9-17)25-13-16-7-3-6-10-19(16)31-2/h3,6-7,10,14,17H,4-5,8-9,11-13H2,1-2H3,(H,23,29)(H,24,30)(H2,25,26,27,28) |
| InChIKey | ORYKMIWQJHCMKB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|