C48H48BrCl2NO2 — CID 71553623
[6,6-dibutyl-1,11-dichloro-4-[hydroxy(diphenyl)methyl]-5,7-dihydrobenzo[d][2]benzazepin-6-ium-8-yl]-diphenylmethanol bromide (PubChem CID 71553623) has the molecular formula C48H48BrCl2NO2 and a molecular weight of 821.73 g/mol. Its IUPAC name is [6,6-dibutyl-1,11-dichloro-4-[hydroxy(diphenyl)methyl]-5,7-dihydrobenzo[d][2]benzazepin-6-ium-8-yl]-diphenylmethanol bromide.
| Compound Name | [6,6-dibutyl-1,11-dichloro-4-[hydroxy(diphenyl)methyl]-5,7-dihydrobenzo[d][2]benzazepin-6-ium-8-yl]-diphenylmethanol bromide |
|---|---|
| PubChem CID | 71553623 |
| Molecular Formula | C48H48BrCl2NO2 |
| Molecular Weight | 821.73 g/mol |
| Exact Mass | 819.22 |
| IUPAC Name | [6,6-dibutyl-1,11-dichloro-4-[hydroxy(diphenyl)methyl]-5,7-dihydrobenzo[d][2]benzazepin-6-ium-8-yl]-diphenylmethanol bromide |
| SMILES | CCCC[N+]1(CCCC)Cc2c(C(O)(c3ccccc3)c3ccccc3)ccc(Cl)c2-c2c(Cl)ccc(C(O)(c3ccccc3)c3ccccc3)c2C1.[Br-] |
| InChI | InChI=1S/C48H48Cl2NO2.BrH/c1-3-5-31-51(32-6-4-2)33-39-41(47(52,35-19-11-7-12-20-35)36-21-13-8-14-22-36)27-29-43(49)45(39)46-40(34-51)42(28-30-44(46)50)48(53,37-23-15-9-16-24-37)38-25-17-10-18-26-38;/h7-30,52-53H,3-6,31-34H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BTPFBBWVWAVAJJ-UHFFFAOYSA-M |
| XLogP | 8.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.73 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|