C19H16N2O4 — CID 71558698
N-(4-methoxyphenyl)-9,11-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-10-carboxamide (PubChem CID 71558698) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-9,11-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-10-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-9,11-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-10-carboxamide |
|---|---|
| PubChem CID | 71558698 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-(4-methoxyphenyl)-9,11-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-10-carboxamide |
| SMILES | COc1ccc(NC(=O)C2C(=O)c3cccc4c3N(CC4)C2=O)cc1 |
| InChI | InChI=1S/C19H16N2O4/c1-25-13-7-5-12(6-8-13)20-18(23)15-17(22)14-4-2-3-11-9-10-21(16(11)14)19(15)24/h2-8,15H,9-10H2,1H3,(H,20,23) |
| InChIKey | YQISDPZRXHJHKH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|