C20H28O2Si — CID 71561094
(4R)-4-[dimethyl(phenyl)silyl]-5-(3-methoxyphenyl)pentan-1-ol (PubChem CID 71561094) has the molecular formula C20H28O2Si and a molecular weight of 328.53 g/mol. Its IUPAC name is (4R)-4-[dimethyl(phenyl)silyl]-5-(3-methoxyphenyl)pentan-1-ol.
| Compound Name | (4R)-4-[dimethyl(phenyl)silyl]-5-(3-methoxyphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 71561094 |
| Molecular Formula | C20H28O2Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (4R)-4-[dimethyl(phenyl)silyl]-5-(3-methoxyphenyl)pentan-1-ol |
| SMILES | COc1cccc(C[C@@H](CCCO)[Si](C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C20H28O2Si/c1-22-18-10-7-9-17(15-18)16-20(13-8-14-21)23(2,3)19-11-5-4-6-12-19/h4-7,9-12,15,20-21H,8,13-14,16H2,1-3H3/t20-/m1/s1 |
| InChIKey | HSYGFSSELHDFQA-HXUWFJFHSA-N |
| XLogP | 4.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|