C41H52N6O8 — CID 71561399
(2S)-6-[bis[[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]imidazol-2-yl]methyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (PubChem CID 71561399) has the molecular formula C41H52N6O8 and a molecular weight of 756.90 g/mol. Its IUPAC name is (2S)-6-[bis[[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]imidazol-2-yl]methyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-6-[bis[[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]imidazol-2-yl]methyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 71561399 |
| Molecular Formula | C41H52N6O8 |
| Molecular Weight | 756.90 g/mol |
| Exact Mass | 756.38 |
| IUPAC Name | (2S)-6-[bis[[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]imidazol-2-yl]methyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| SMILES | CC(C)(C)OC(=O)Cn1ccnc1CN(CCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)Cc1nccn1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C41H52N6O8/c1-40(2,3)54-36(48)25-46-21-18-42-34(46)23-45(24-35-43-19-22-47(35)26-37(49)55-41(4,5)6)20-12-11-17-33(38(50)51)44-39(52)53-27-32-30-15-9-7-13-28(30)29-14-8-10-16-31(29)32/h7-10,13-16,18-19,21-22,32-33H,11-12,17,20,23-27H2,1-6H3,(H,44,52)(H,50,51)/t33-/m0/s1 |
| InChIKey | MMUPNRPQMNBDLI-XIFFEERXSA-N |
| XLogP | 5.93 |
| TPSA | 167.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.90 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|