C23H30N2O4S — CID 71561651
2-[[4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]phenyl]methylsulfonyl]acetamide (PubChem CID 71561651) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is 2-[[4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]phenyl]methylsulfonyl]acetamide.
| Compound Name | 2-[[4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]phenyl]methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 71561651 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-[[4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]phenyl]methylsulfonyl]acetamide |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc(-c2ccc(CS(=O)(=O)CC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-18-4-2-13-25(18)14-3-15-29-22-11-9-21(10-12-22)20-7-5-19(6-8-20)16-30(27,28)17-23(24)26/h5-12,18H,2-4,13-17H2,1H3,(H2,24,26)/t18-/m1/s1 |
| InChIKey | WUFOPZVWBAJCGQ-GOSISDBHSA-N |
| XLogP | 3.01 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|