C16H19N3O5S — CID 71562191
N-[3-(butylcarbamoyl)-5-ethylthiophen-2-yl]-5-nitrofuran-2-carboxamide (PubChem CID 71562191) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[3-(butylcarbamoyl)-5-ethylthiophen-2-yl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[3-(butylcarbamoyl)-5-ethylthiophen-2-yl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 71562191 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[3-(butylcarbamoyl)-5-ethylthiophen-2-yl]-5-nitrofuran-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc(CC)sc1NC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C16H19N3O5S/c1-3-5-8-17-14(20)11-9-10(4-2)25-16(11)18-15(21)12-6-7-13(24-12)19(22)23/h6-7,9H,3-5,8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | VEMGZBDNDCSERA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|