C17H18ClNO — CID 71562472
(3R)-3-[(S)-(4-chlorophenoxy)-phenylmethyl]pyrrolidine (PubChem CID 71562472) has the molecular formula C17H18ClNO and a molecular weight of 287.79 g/mol. Its IUPAC name is (3R)-3-[(S)-(4-chlorophenoxy)-phenylmethyl]pyrrolidine.
| Compound Name | (3R)-3-[(S)-(4-chlorophenoxy)-phenylmethyl]pyrrolidine |
|---|---|
| PubChem CID | 71562472 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (3R)-3-[(S)-(4-chlorophenoxy)-phenylmethyl]pyrrolidine |
| SMILES | Clc1ccc(O[C@H](c2ccccc2)[C@@H]2CCNC2)cc1 |
| InChI | InChI=1S/C17H18ClNO/c18-15-6-8-16(9-7-15)20-17(14-10-11-19-12-14)13-4-2-1-3-5-13/h1-9,14,17,19H,10-12H2/t14-,17-/m1/s1 |
| InChIKey | FDZMWAFQMOJQFO-RHSMWYFYSA-N |
| XLogP | 4.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |