C10H10N2O3 — CID 71563531
1-(3-methoxyphenyl)pyrazolidine-3,5-dione (PubChem CID 71563531) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)pyrazolidine-3,5-dione.
| Compound Name | 1-(3-methoxyphenyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 71563531 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 1-(3-methoxyphenyl)pyrazolidine-3,5-dione |
| SMILES | COc1cccc(N2NC(=O)CC2=O)c1 |
| InChI | InChI=1S/C10H10N2O3/c1-15-8-4-2-3-7(5-8)12-10(14)6-9(13)11-12/h2-5H,6H2,1H3,(H,11,13) |
| InChIKey | GIWGDOKQVCNTSX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|