C9H7ClFN3O — CID 71563604
3-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-4-fluoroaniline (PubChem CID 71563604) has the molecular formula C9H7ClFN3O and a molecular weight of 227.63 g/mol. Its IUPAC name is 3-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-4-fluoroaniline.
| Compound Name | 3-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-4-fluoroaniline |
|---|---|
| PubChem CID | 71563604 |
| Molecular Formula | C9H7ClFN3O |
| Molecular Weight | 227.63 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 3-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-4-fluoroaniline |
| SMILES | Nc1ccc(F)c(-c2nnc(CCl)o2)c1 |
| InChI | InChI=1S/C9H7ClFN3O/c10-4-8-13-14-9(15-8)6-3-5(12)1-2-7(6)11/h1-3H,4,12H2 |
| InChIKey | WDCPJBZXUMEVQN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.63 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|