C18H24N4O3 — CID 71563908
3-[4-oxo-2-(4-propan-2-ylpiperazin-1-yl)quinazolin-3-yl]propanoic acid (PubChem CID 71563908) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-[4-oxo-2-(4-propan-2-ylpiperazin-1-yl)quinazolin-3-yl]propanoic acid.
| Compound Name | 3-[4-oxo-2-(4-propan-2-ylpiperazin-1-yl)quinazolin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 71563908 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-[4-oxo-2-(4-propan-2-ylpiperazin-1-yl)quinazolin-3-yl]propanoic acid |
| SMILES | CC(C)N1CCN(c2nc3ccccc3c(=O)n2CCC(=O)O)CC1 |
| InChI | InChI=1S/C18H24N4O3/c1-13(2)20-9-11-21(12-10-20)18-19-15-6-4-3-5-14(15)17(25)22(18)8-7-16(23)24/h3-6,13H,7-12H2,1-2H3,(H,23,24) |
| InChIKey | WZCRJNJVPBJYKU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |