C15H22N4 — CID 71565268
8-N-(4-aminopentyl)-6-N-methylquinoline-6,8-diamine (PubChem CID 71565268) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 8-N-(4-aminopentyl)-6-N-methylquinoline-6,8-diamine.
| Compound Name | 8-N-(4-aminopentyl)-6-N-methylquinoline-6,8-diamine |
|---|---|
| PubChem CID | 71565268 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 8-N-(4-aminopentyl)-6-N-methylquinoline-6,8-diamine |
| SMILES | CNc1cc(NCCCC(C)N)c2ncccc2c1 |
| InChI | InChI=1S/C15H22N4/c1-11(16)5-3-7-18-14-10-13(17-2)9-12-6-4-8-19-15(12)14/h4,6,8-11,17-18H,3,5,7,16H2,1-2H3 |
| InChIKey | BDNJKGLTIKIVCX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|