C17H29NO6 — CID 71566819
1-O-tert-butyl 2-O-methyl (2S,4R)-5-acetyloxy-4-methyl-4-propylpyrrolidine-1,2-dicarboxylate (PubChem CID 71566819) has the molecular formula C17H29NO6 and a molecular weight of 343.42 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-5-acetyloxy-4-methyl-4-propylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-5-acetyloxy-4-methyl-4-propylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71566819 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-5-acetyloxy-4-methyl-4-propylpyrrolidine-1,2-dicarboxylate |
| SMILES | CCC[C@]1(C)C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C1OC(C)=O |
| InChI | InChI=1S/C17H29NO6/c1-8-9-17(6)10-12(13(20)22-7)18(14(17)23-11(2)19)15(21)24-16(3,4)5/h12,14H,8-10H2,1-7H3/t12-,14?,17+/m0/s1 |
| InChIKey | IMFUIZASKDFPLO-WAPNNBGYSA-N |
| XLogP | 2.86 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|