C24H25NO2 — CID 71567776
N,N-diethyl-2-methoxy-6-[(Z)-2-naphthalen-2-ylethenyl]benzamide (PubChem CID 71567776) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is N,N-diethyl-2-methoxy-6-[(Z)-2-naphthalen-2-ylethenyl]benzamide.
| Compound Name | N,N-diethyl-2-methoxy-6-[(Z)-2-naphthalen-2-ylethenyl]benzamide |
|---|---|
| PubChem CID | 71567776 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | N,N-diethyl-2-methoxy-6-[(Z)-2-naphthalen-2-ylethenyl]benzamide |
| SMILES | CCN(CC)C(=O)c1c(/C=C\c2ccc3ccccc3c2)cccc1OC |
| InChI | InChI=1S/C24H25NO2/c1-4-25(5-2)24(26)23-20(11-8-12-22(23)27-3)16-14-18-13-15-19-9-6-7-10-21(19)17-18/h6-17H,4-5H2,1-3H3/b16-14- |
| InChIKey | NJHJOOAWCOWXCF-PEZBUJJGSA-N |
| XLogP | 5.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|