C28H19F3N2O2 — CID 71567943
[2-(4-phenylmethoxyphenyl)-3H-benzimidazol-5-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 71567943) has the molecular formula C28H19F3N2O2 and a molecular weight of 472.47 g/mol. Its IUPAC name is [2-(4-phenylmethoxyphenyl)-3H-benzimidazol-5-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [2-(4-phenylmethoxyphenyl)-3H-benzimidazol-5-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 71567943 |
| Molecular Formula | C28H19F3N2O2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [2-(4-phenylmethoxyphenyl)-3H-benzimidazol-5-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc2nc(-c3ccc(OCc4ccccc4)cc3)[nH]c2c1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H19F3N2O2/c29-28(30,31)23-9-5-4-8-22(23)26(34)20-12-15-24-25(16-20)33-27(32-24)19-10-13-21(14-11-19)35-17-18-6-2-1-3-7-18/h1-16H,17H2,(H,32,33) |
| InChIKey | UHQKPUHMBPUMTP-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |