C30H47N3O9S — CID 71568711
4-[[(E)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]-N-(2-sulfanylethyl)carbamimidoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl 4-methoxybenzoate (PubChem CID 71568711) has the molecular formula C30H47N3O9S and a molecular weight of 625.79 g/mol. Its IUPAC name is 4-[[(E)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]-N-(2-sulfanylethyl)carbamimidoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl 4-methoxybenzoate.
| Compound Name | 4-[[(E)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]-N-(2-sulfanylethyl)carbamimidoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl 4-methoxybenzoate |
|---|---|
| PubChem CID | 71568711 |
| Molecular Formula | C30H47N3O9S |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.30 |
| IUPAC Name | 4-[[(E)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]-N-(2-sulfanylethyl)carbamimidoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCCCCN(C(=O)OC(C)(C)C)/C(=N\C(=O)OC(C)(C)C)N(CCS)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H47N3O9S/c1-28(2,3)40-25(35)31-24(33(18-20-43)27(37)42-30(7,8)9)32(26(36)41-29(4,5)6)17-11-12-19-39-23(34)21-13-15-22(38-10)16-14-21/h13-16,43H,11-12,17-20H2,1-10H3/b31-24+ |
| InChIKey | HTSKTUQCSDTTQD-QFMPWRQOSA-N |
| XLogP | 6.33 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|