C14H16ClN3O3S — CID 71568993
1-[(2S)-3-amino-2-hydroxypropyl]-6-(5-chloro-2-methoxyphenyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 71568993) has the molecular formula C14H16ClN3O3S and a molecular weight of 341.82 g/mol. Its IUPAC name is 1-[(2S)-3-amino-2-hydroxypropyl]-6-(5-chloro-2-methoxyphenyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-[(2S)-3-amino-2-hydroxypropyl]-6-(5-chloro-2-methoxyphenyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 71568993 |
| Molecular Formula | C14H16ClN3O3S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 1-[(2S)-3-amino-2-hydroxypropyl]-6-(5-chloro-2-methoxyphenyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | COc1ccc(Cl)cc1-c1cc(=O)[nH]c(=S)n1C[C@@H](O)CN |
| InChI | InChI=1S/C14H16ClN3O3S/c1-21-12-3-2-8(15)4-10(12)11-5-13(20)17-14(22)18(11)7-9(19)6-16/h2-5,9,19H,6-7,16H2,1H3,(H,17,20,22)/t9-/m0/s1 |
| InChIKey | HPFDHBGXTIYXID-VIFPVBQESA-N |
| XLogP | 1.55 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|