C35H41N5O8 — CID 71570265
[4-[4-amino-6,7-dimethoxy-5,8-bis(2-phenoxyethoxy)quinazolin-2-yl]piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 71570265) has the molecular formula C35H41N5O8 and a molecular weight of 659.74 g/mol. Its IUPAC name is [4-[4-amino-6,7-dimethoxy-5,8-bis(2-phenoxyethoxy)quinazolin-2-yl]piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[4-amino-6,7-dimethoxy-5,8-bis(2-phenoxyethoxy)quinazolin-2-yl]piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 71570265 |
| Molecular Formula | C35H41N5O8 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | [4-[4-amino-6,7-dimethoxy-5,8-bis(2-phenoxyethoxy)quinazolin-2-yl]piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | COc1c(OC)c(OCCOc2ccccc2)c2c(N)nc(N3CCN(C(=O)C4CCCO4)CC3)nc2c1OCCOc1ccccc1 |
| InChI | InChI=1S/C35H41N5O8/c1-42-31-29(47-22-20-44-24-10-5-3-6-11-24)27-28(30(32(31)43-2)48-23-21-45-25-12-7-4-8-13-25)37-35(38-33(27)36)40-17-15-39(16-18-40)34(41)26-14-9-19-46-26/h3-8,10-13,26H,9,14-23H2,1-2H3,(H2,36,37,38) |
| InChIKey | BUIZMNOVJSUUSB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|