C31H33N3O4 — CID 71570623
5-acetyl-6-[4-(diethylamino)phenyl]-9-(3,4-dihydroxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 71570623) has the molecular formula C31H33N3O4 and a molecular weight of 511.62 g/mol. Its IUPAC name is 5-acetyl-6-[4-(diethylamino)phenyl]-9-(3,4-dihydroxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-acetyl-6-[4-(diethylamino)phenyl]-9-(3,4-dihydroxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 71570623 |
| Molecular Formula | C31H33N3O4 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 5-acetyl-6-[4-(diethylamino)phenyl]-9-(3,4-dihydroxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCN(CC)c1ccc(C2C3=C(CC(c4ccc(O)c(O)c4)CC3=O)Nc3ccccc3N2C(C)=O)cc1 |
| InChI | InChI=1S/C31H33N3O4/c1-4-33(5-2)23-13-10-20(11-14-23)31-30-25(32-24-8-6-7-9-26(24)34(31)19(3)35)16-22(18-29(30)38)21-12-15-27(36)28(37)17-21/h6-15,17,22,31-32,36-37H,4-5,16,18H2,1-3H3 |
| InChIKey | USXMQIKWQCQQKX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|