C10H13NO2 — CID 7157331
(1R)-1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 7157331) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (1R)-1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | (1R)-1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 7157331 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (1R)-1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | C[C@H]1NCCc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C10H13NO2/c1-6-8-5-10(13)9(12)4-7(8)2-3-11-6/h4-6,11-13H,2-3H2,1H3/t6-/m1/s1 |
| InChIKey | IBRKLUSXDYATLG-ZCFIWIBFSA-N |
| XLogP | 1.30 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|