C10H7Cl3O4 — CID 71573654
(Z)-1,1,1-trichloro-4-(3,5-dihydroxyphenyl)-4-hydroxybut-3-en-2-one (PubChem CID 71573654) has the molecular formula C10H7Cl3O4 and a molecular weight of 297.52 g/mol. Its IUPAC name is (Z)-1,1,1-trichloro-4-(3,5-dihydroxyphenyl)-4-hydroxybut-3-en-2-one.
| Compound Name | (Z)-1,1,1-trichloro-4-(3,5-dihydroxyphenyl)-4-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 71573654 |
| Molecular Formula | C10H7Cl3O4 |
| Molecular Weight | 297.52 g/mol |
| Exact Mass | 295.94 |
| IUPAC Name | (Z)-1,1,1-trichloro-4-(3,5-dihydroxyphenyl)-4-hydroxybut-3-en-2-one |
| SMILES | O=C(/C=C(\O)c1cc(O)cc(O)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H7Cl3O4/c11-10(12,13)9(17)4-8(16)5-1-6(14)3-7(15)2-5/h1-4,14-16H/b8-4- |
| InChIKey | YPHCMIREOLATMX-YWEYNIOJSA-N |
| XLogP | 2.94 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|