C15H17NO2 — CID 71573718
(4aS)-2-ethyl-4,4a,5,6-tetrahydrobenzo[f]quinolizine-1,3-dione (PubChem CID 71573718) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (4aS)-2-ethyl-4,4a,5,6-tetrahydrobenzo[f]quinolizine-1,3-dione.
| Compound Name | (4aS)-2-ethyl-4,4a,5,6-tetrahydrobenzo[f]quinolizine-1,3-dione |
|---|---|
| PubChem CID | 71573718 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (4aS)-2-ethyl-4,4a,5,6-tetrahydrobenzo[f]quinolizine-1,3-dione |
| SMILES | CCC1C(=O)C[C@@H]2CCc3ccccc3N2C1=O |
| InChI | InChI=1S/C15H17NO2/c1-2-12-14(17)9-11-8-7-10-5-3-4-6-13(10)16(11)15(12)18/h3-6,11-12H,2,7-9H2,1H3/t11-,12?/m0/s1 |
| InChIKey | FWDMPEUOPRVXAP-PXYINDEMSA-N |
| XLogP | 2.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|