C15H20N2O6 — CID 71574834
(2S,4R)-2-amino-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioic acid (PubChem CID 71574834) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is (2S,4R)-2-amino-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioic acid.
| Compound Name | (2S,4R)-2-amino-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioic acid |
|---|---|
| PubChem CID | 71574834 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (2S,4R)-2-amino-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioic acid |
| SMILES | N[C@@H](C[C@@H](CCC(=O)NOCc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H20N2O6/c16-12(15(21)22)8-11(14(19)20)6-7-13(18)17-23-9-10-4-2-1-3-5-10/h1-5,11-12H,6-9,16H2,(H,17,18)(H,19,20)(H,21,22)/t11-,12+/m1/s1 |
| InChIKey | ZKSKFGAGRKUTPH-NEPJUHHUSA-N |
| XLogP | 0.52 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|