C31H33ClF3N5O4 — CID 71575136
1-[3-[4-[6-chloro-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenoxy]propyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 71575136) has the molecular formula C31H33ClF3N5O4 and a molecular weight of 632.08 g/mol. Its IUPAC name is 1-[3-[4-[6-chloro-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenoxy]propyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[3-[4-[6-chloro-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenoxy]propyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 71575136 |
| Molecular Formula | C31H33ClF3N5O4 |
| Molecular Weight | 632.08 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | 1-[3-[4-[6-chloro-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenoxy]propyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | COc1cc(-c2nc3ccc(Cl)cn3c2NC2CCCCC2)ccc1OCCCNC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C31H33ClF3N5O4/c1-42-26-18-20(28-29(37-22-6-3-2-4-7-22)40-19-21(32)9-15-27(40)39-28)8-14-25(26)43-17-5-16-36-30(41)38-23-10-12-24(13-11-23)44-31(33,34)35/h8-15,18-19,22,37H,2-7,16-17H2,1H3,(H2,36,38,41) |
| InChIKey | UHNUFPLLWSSNDX-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.08 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|