C29H32N4O4 — CID 71575206
[2-(ethylcarbamoyloxymethyl)-9-methyl-1-phenyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methyl N-ethylcarbamate (PubChem CID 71575206) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is [2-(ethylcarbamoyloxymethyl)-9-methyl-1-phenyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methyl N-ethylcarbamate.
| Compound Name | [2-(ethylcarbamoyloxymethyl)-9-methyl-1-phenyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 71575206 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | [2-(ethylcarbamoyloxymethyl)-9-methyl-1-phenyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCc1c(COC(=O)NCC)c(-c2ccccc2)n2c1Cc1c(n(C)c3ccccc13)C2 |
| InChI | InChI=1S/C29H32N4O4/c1-4-30-28(34)36-17-22-23(18-37-29(35)31-5-2)27(19-11-7-6-8-12-19)33-16-26-21(15-25(22)33)20-13-9-10-14-24(20)32(26)3/h6-14H,4-5,15-18H2,1-3H3,(H,30,34)(H,31,35) |
| InChIKey | YNFQXRIVCPPBGY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|