C20H23NO5 — CID 71575534
2-methoxy-5-[(5,6,7-trimethoxy-1-methylindol-3-yl)methyl]phenol (PubChem CID 71575534) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-methoxy-5-[(5,6,7-trimethoxy-1-methylindol-3-yl)methyl]phenol.
| Compound Name | 2-methoxy-5-[(5,6,7-trimethoxy-1-methylindol-3-yl)methyl]phenol |
|---|---|
| PubChem CID | 71575534 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-methoxy-5-[(5,6,7-trimethoxy-1-methylindol-3-yl)methyl]phenol |
| SMILES | COc1ccc(Cc2cn(C)c3c(OC)c(OC)c(OC)cc23)cc1O |
| InChI | InChI=1S/C20H23NO5/c1-21-11-13(8-12-6-7-16(23-2)15(22)9-12)14-10-17(24-3)19(25-4)20(26-5)18(14)21/h6-7,9-11,22H,8H2,1-5H3 |
| InChIKey | BOTLXQNBAJWCCK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 62.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |