C18H16F6N4O2S — CID 71582586
3-[3,5-dimethyl-4-[3-[5-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-yl]propoxy]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole (PubChem CID 71582586) has the molecular formula C18H16F6N4O2S and a molecular weight of 466.41 g/mol. Its IUPAC name is 3-[3,5-dimethyl-4-[3-[5-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-yl]propoxy]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[3,5-dimethyl-4-[3-[5-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-yl]propoxy]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 71582586 |
| Molecular Formula | C18H16F6N4O2S |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 3-[3,5-dimethyl-4-[3-[5-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-yl]propoxy]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(-c2noc(C(F)(F)F)n2)cc(C)c1OCCCc1nnc(CC(F)(F)F)s1 |
| InChI | InChI=1S/C18H16F6N4O2S/c1-9-6-11(15-25-16(30-28-15)18(22,23)24)7-10(2)14(9)29-5-3-4-12-26-27-13(31-12)8-17(19,20)21/h6-7H,3-5,8H2,1-2H3 |
| InChIKey | OGUWCHOVNIVBSD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|