C19H16F3N5O3 — CID 90449135
5-[3-[2,6-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]propoxy]pyrazine-2-carbonitrile (PubChem CID 90449135) has the molecular formula C19H16F3N5O3 and a molecular weight of 419.36 g/mol. Its IUPAC name is 5-[3-[2,6-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]propoxy]pyrazine-2-carbonitrile.
| Compound Name | 5-[3-[2,6-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]propoxy]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 90449135 |
| Molecular Formula | C19H16F3N5O3 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 5-[3-[2,6-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]propoxy]pyrazine-2-carbonitrile |
| SMILES | Cc1cc(-c2noc(C(F)(F)F)n2)cc(C)c1OCCCOc1cnc(C#N)cn1 |
| InChI | InChI=1S/C19H16F3N5O3/c1-11-6-13(17-26-18(30-27-17)19(20,21)22)7-12(2)16(11)29-5-3-4-28-15-10-24-14(8-23)9-25-15/h6-7,9-10H,3-5H2,1-2H3 |
| InChIKey | OGNBLKDVGFKKAG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 106.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|