C21H19Cl2F3N2O3 — CID 90449151
3-[4-[3-(2,6-dichloro-4-methylphenoxy)propoxy]-3,5-dimethylphenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole (PubChem CID 90449151) has the molecular formula C21H19Cl2F3N2O3 and a molecular weight of 475.29 g/mol. Its IUPAC name is 3-[4-[3-(2,6-dichloro-4-methylphenoxy)propoxy]-3,5-dimethylphenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-[3-(2,6-dichloro-4-methylphenoxy)propoxy]-3,5-dimethylphenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 90449151 |
| Molecular Formula | C21H19Cl2F3N2O3 |
| Molecular Weight | 475.29 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 3-[4-[3-(2,6-dichloro-4-methylphenoxy)propoxy]-3,5-dimethylphenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(Cl)c(OCCCOc2c(C)cc(-c3noc(C(F)(F)F)n3)cc2C)c(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2F3N2O3/c1-11-7-15(22)18(16(23)8-11)30-6-4-5-29-17-12(2)9-14(10-13(17)3)19-27-20(31-28-19)21(24,25)26/h7-10H,4-6H2,1-3H3 |
| InChIKey | GFXOMKYDLABLKO-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.29 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|