C21H21F3N4O4 — CID 71582680
(E)-1-[6-[2-[2,6-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethoxy]-3-pyridinyl]-N-ethoxymethanimine (PubChem CID 71582680) has the molecular formula C21H21F3N4O4 and a molecular weight of 450.42 g/mol. Its IUPAC name is (E)-1-[6-[2-[2,6-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethoxy]-3-pyridinyl]-N-ethoxymethanimine.
| Compound Name | (E)-1-[6-[2-[2,6-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethoxy]-3-pyridinyl]-N-ethoxymethanimine |
|---|---|
| PubChem CID | 71582680 |
| Molecular Formula | C21H21F3N4O4 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (E)-1-[6-[2-[2,6-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethoxy]-3-pyridinyl]-N-ethoxymethanimine |
| SMILES | CCO/N=C/c1ccc(OCCOc2c(C)cc(-c3noc(C(F)(F)F)n3)cc2C)nc1 |
| InChI | InChI=1S/C21H21F3N4O4/c1-4-31-26-12-15-5-6-17(25-11-15)29-7-8-30-18-13(2)9-16(10-14(18)3)19-27-20(32-28-19)21(22,23)24/h5-6,9-12H,4,7-8H2,1-3H3/b26-12+ |
| InChIKey | ZBTLNKRSNKVGBZ-RPPGKUMJSA-N |
| XLogP | 4.60 |
| TPSA | 91.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|