C24H41NO2 — CID 71583072
(1R,3aR,4S,5S,7aR)-5-(furan-3-ylmethylamino)-3a,7a-dimethyl-1-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7-hexahydro-1H-inden-4-ol (PubChem CID 71583072) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is (1R,3aR,4S,5S,7aR)-5-(furan-3-ylmethylamino)-3a,7a-dimethyl-1-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7-hexahydro-1H-inden-4-ol.
| Compound Name | (1R,3aR,4S,5S,7aR)-5-(furan-3-ylmethylamino)-3a,7a-dimethyl-1-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7-hexahydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 71583072 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | (1R,3aR,4S,5S,7aR)-5-(furan-3-ylmethylamino)-3a,7a-dimethyl-1-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7-hexahydro-1H-inden-4-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@@]2(C)[C@H](O)[C@@H](NCc3ccoc3)CC[C@]12C |
| InChI | InChI=1S/C24H41NO2/c1-17(2)7-6-8-18(3)20-9-12-24(5)22(26)21(10-13-23(20,24)4)25-15-19-11-14-27-16-19/h11,14,16-18,20-22,25-26H,6-10,12-13,15H2,1-5H3/t18-,20-,21+,22-,23-,24+/m1/s1 |
| InChIKey | BDZTXNUVDKOFAO-KAJOGEKBSA-N |
| XLogP | 5.78 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |