C24H23N5O2 — CID 71584271
N-(2-methoxyethyl)-4-[[6-(2-methyl-4-pyridinyl)quinazolin-2-yl]amino]benzamide (PubChem CID 71584271) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[[6-(2-methyl-4-pyridinyl)quinazolin-2-yl]amino]benzamide.
| Compound Name | N-(2-methoxyethyl)-4-[[6-(2-methyl-4-pyridinyl)quinazolin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 71584271 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-(2-methoxyethyl)-4-[[6-(2-methyl-4-pyridinyl)quinazolin-2-yl]amino]benzamide |
| SMILES | COCCNC(=O)c1ccc(Nc2ncc3cc(-c4ccnc(C)c4)ccc3n2)cc1 |
| InChI | InChI=1S/C24H23N5O2/c1-16-13-19(9-10-25-16)18-5-8-22-20(14-18)15-27-24(29-22)28-21-6-3-17(4-7-21)23(30)26-11-12-31-2/h3-10,13-15H,11-12H2,1-2H3,(H,26,30)(H,27,28,29) |
| InChIKey | KFLXEKIKIYSSNO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|