C23H25NO4S — CID 71586470
(3-methoxyphenyl)methyl 3-(4-aminocyclohexyl)oxy-1-benzothiophene-2-carboxylate (PubChem CID 71586470) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 3-(4-aminocyclohexyl)oxy-1-benzothiophene-2-carboxylate.
| Compound Name | (3-methoxyphenyl)methyl 3-(4-aminocyclohexyl)oxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 71586470 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (3-methoxyphenyl)methyl 3-(4-aminocyclohexyl)oxy-1-benzothiophene-2-carboxylate |
| SMILES | COc1cccc(COC(=O)c2sc3ccccc3c2OC2CCC(N)CC2)c1 |
| InChI | InChI=1S/C23H25NO4S/c1-26-18-6-4-5-15(13-18)14-27-23(25)22-21(19-7-2-3-8-20(19)29-22)28-17-11-9-16(24)10-12-17/h2-8,13,16-17H,9-12,14,24H2,1H3 |
| InChIKey | FIOXNAJXUHXNLB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |