C16H13N3O3 — CID 71591427
(3-pyridin-2-yl-1,2-oxazol-5-yl)methyl N-phenylcarbamate (PubChem CID 71591427) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is (3-pyridin-2-yl-1,2-oxazol-5-yl)methyl N-phenylcarbamate.
| Compound Name | (3-pyridin-2-yl-1,2-oxazol-5-yl)methyl N-phenylcarbamate |
|---|---|
| PubChem CID | 71591427 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (3-pyridin-2-yl-1,2-oxazol-5-yl)methyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCc1cc(-c2ccccn2)no1 |
| InChI | InChI=1S/C16H13N3O3/c20-16(18-12-6-2-1-3-7-12)21-11-13-10-15(19-22-13)14-8-4-5-9-17-14/h1-10H,11H2,(H,18,20) |
| InChIKey | OBUQNWNGMQBEDH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |