About [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile
[(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile (PubChem CID 71594217) has the molecular formula C16H20N2OS
and a molecular weight of 288.42 g/mol. Its IUPAC name is [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile.
Molecular Properties
| Compound Name | [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile |
| PubChem CID | 71594217 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile |
| SMILES | CCc1c(C)nc2ccc(OC)cc2c1S(C)(C)C#N |
| InChI | InChI=1S/C16H20N2OS/c1-6-13-11(2)18-15-8-7-12(19-3)9-14(15)16(13)20(4,5)10-17/h7-9H,6H2,1-5H3 |
| InChIKey | ULNZEGGHCSOTAP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile?
The IUPAC name of [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile (CID 71594217) is [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile.
What is the SMILES notation for [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile?
The canonical SMILES for [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile is CCc1c(C)nc2ccc(OC)cc2c1S(C)(C)C#N.
What is the InChIKey of [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile?
The InChIKey is ULNZEGGHCSOTAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2OS/c1-6-13-11(2)18-15-8-7-12(19-3)9-14(15)16(13)20(4,5)10-17/h7-9H,6H2,1-5H3.
What are the key properties of [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile?
[(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile has a molecular weight of 288.42 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-ethyl-6-methoxy-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile is sourced from PubChem (CID 71594217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).