C24H34O6 — CID 71594694
2-[[(3R,3aS,4S,6S,8aR)-3,6-dihydroxy-6,8a-dimethyl-3-propan-2-yl-2,3a,4,5-tetrahydro-1H-azulen-4-yl]oxy]-1-(4-hydroxy-3-methoxyphenyl)ethanone (PubChem CID 71594694) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is 2-[[(3R,3aS,4S,6S,8aR)-3,6-dihydroxy-6,8a-dimethyl-3-propan-2-yl-2,3a,4,5-tetrahydro-1H-azulen-4-yl]oxy]-1-(4-hydroxy-3-methoxyphenyl)ethanone.
| Compound Name | 2-[[(3R,3aS,4S,6S,8aR)-3,6-dihydroxy-6,8a-dimethyl-3-propan-2-yl-2,3a,4,5-tetrahydro-1H-azulen-4-yl]oxy]-1-(4-hydroxy-3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 71594694 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 2-[[(3R,3aS,4S,6S,8aR)-3,6-dihydroxy-6,8a-dimethyl-3-propan-2-yl-2,3a,4,5-tetrahydro-1H-azulen-4-yl]oxy]-1-(4-hydroxy-3-methoxyphenyl)ethanone |
| SMILES | COc1cc(C(=O)CO[C@H]2C[C@](C)(O)C=C[C@@]3(C)CC[C@@](O)(C(C)C)[C@H]23)ccc1O |
| InChI | InChI=1S/C24H34O6/c1-15(2)24(28)11-9-22(3)8-10-23(4,27)13-20(21(22)24)30-14-18(26)16-6-7-17(25)19(12-16)29-5/h6-8,10,12,15,20-21,25,27-28H,9,11,13-14H2,1-5H3/t20-,21+,22-,23+,24+/m0/s1 |
| InChIKey | XZKIEWZQSIGAKO-OEYYQIPYSA-N |
| XLogP | 3.48 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|