C17H14Cl2N6O — CID 71595759
4-[[6-[(2,6-dichlorophenyl)methyl]-4-(hydroxyamino)-1,4-dihydro-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 71595759) has the molecular formula C17H14Cl2N6O and a molecular weight of 389.25 g/mol. Its IUPAC name is 4-[[6-[(2,6-dichlorophenyl)methyl]-4-(hydroxyamino)-1,4-dihydro-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[6-[(2,6-dichlorophenyl)methyl]-4-(hydroxyamino)-1,4-dihydro-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 71595759 |
| Molecular Formula | C17H14Cl2N6O |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 4-[[6-[(2,6-dichlorophenyl)methyl]-4-(hydroxyamino)-1,4-dihydro-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(NC2=NC(NO)N=C(Cc3c(Cl)cccc3Cl)N2)cc1 |
| InChI | InChI=1S/C17H14Cl2N6O/c18-13-2-1-3-14(19)12(13)8-15-22-16(24-17(23-15)25-26)21-11-6-4-10(9-20)5-7-11/h1-7,17,25-26H,8H2,(H2,21,22,23,24) |
| InChIKey | UJKRVDYQCMRBKD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|